C17H17N3O2S3 — CID 17033483
2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 17033483) has the molecular formula C17H17N3O2S3 and a molecular weight of 391.54 g/mol. Its IUPAC name is 2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 17033483 |
| Molecular Formula | C17H17N3O2S3 |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 2-(5-methyl-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)-N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)CN3C(=O)C(C)SC3=S)s2)c1 |
| InChI | InChI=1S/C17H17N3O2S3/c1-10-4-3-5-12(6-10)7-13-8-18-16(25-13)19-14(21)9-20-15(22)11(2)24-17(20)23/h3-6,8,11H,7,9H2,1-2H3,(H,18,19,21) |
| InChIKey | KXFBWUVHZUMIHV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'rhod_sat_A(33)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|