C17H16N2OS2 — CID 18827605
N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 18827605) has the molecular formula C17H16N2OS2 and a molecular weight of 328.46 g/mol. Its IUPAC name is N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 18827605 |
| Molecular Formula | C17H16N2OS2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-[5-[(3-methylphenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1cccc(Cc2cnc(NC(=O)Cc3cccs3)s2)c1 |
| InChI | InChI=1S/C17H16N2OS2/c1-12-4-2-5-13(8-12)9-15-11-18-17(22-15)19-16(20)10-14-6-3-7-21-14/h2-8,11H,9-10H2,1H3,(H,18,19,20) |
| InChIKey | WPAABTFQQMWOKB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|