C16H12Cl2N2OS2 — CID 18827722
N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 18827722) has the molecular formula C16H12Cl2N2OS2 and a molecular weight of 383.33 g/mol. Its IUPAC name is N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 18827722 |
| Molecular Formula | C16H12Cl2N2OS2 |
| Molecular Weight | 383.33 g/mol |
| Exact Mass | 381.98 |
| IUPAC Name | N-[5-[(3,5-dichlorophenyl)methyl]-1,3-thiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ncc(Cc2cc(Cl)cc(Cl)c2)s1 |
| InChI | InChI=1S/C16H12Cl2N2OS2/c17-11-4-10(5-12(18)7-11)6-14-9-19-16(23-14)20-15(21)8-13-2-1-3-22-13/h1-5,7,9H,6,8H2,(H,19,20,21) |
| InChIKey | QJCXJCJCUAZWRO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.33 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_E(2)', 'substructure': 'N/A'} |
|---|