C17H13Cl2N3OS — CID 113036797
N-[5-(3,5-dichloroanilino)-2-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 113036797) has the molecular formula C17H13Cl2N3OS and a molecular weight of 378.28 g/mol. Its IUPAC name is N-[5-(3,5-dichloroanilino)-2-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-(3,5-dichloroanilino)-2-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113036797 |
| Molecular Formula | C17H13Cl2N3OS |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 377.02 |
| IUPAC Name | N-[5-(3,5-dichloroanilino)-2-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2cc(Cl)cc(Cl)c2)cn1 |
| InChI | InChI=1S/C17H13Cl2N3OS/c18-11-6-12(19)8-14(7-11)21-13-3-4-16(20-10-13)22-17(23)9-15-2-1-5-24-15/h1-8,10,21H,9H2,(H,20,22,23) |
| InChIKey | BTIDTVFNRFNGPX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |