C16H13ClN4OS — CID 113047543
N-[6-(4-chloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 113047543) has the molecular formula C16H13ClN4OS and a molecular weight of 344.83 g/mol. Its IUPAC name is N-[6-(4-chloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(4-chloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113047543 |
| Molecular Formula | C16H13ClN4OS |
| Molecular Weight | 344.83 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-[6-(4-chloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2ccc(Cl)cc2)nn1 |
| InChI | InChI=1S/C16H13ClN4OS/c17-11-3-5-12(6-4-11)18-14-7-8-15(21-20-14)19-16(22)10-13-2-1-9-23-13/h1-9H,10H2,(H,18,20)(H,19,21,22) |
| InChIKey | XWHTWPNRZRZKCE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.83 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |