C13H14N4OS — CID 113038208
N-[6-(prop-2-enylamino)pyridazin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 113038208) has the molecular formula C13H14N4OS and a molecular weight of 274.35 g/mol. Its IUPAC name is N-[6-(prop-2-enylamino)pyridazin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(prop-2-enylamino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113038208 |
| Molecular Formula | C13H14N4OS |
| Molecular Weight | 274.35 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | N-[6-(prop-2-enylamino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | C=CCNc1ccc(NC(=O)Cc2cccs2)nn1 |
| InChI | InChI=1S/C13H14N4OS/c1-2-7-14-11-5-6-12(17-16-11)15-13(18)9-10-4-3-8-19-10/h2-6,8H,1,7,9H2,(H,14,16)(H,15,17,18) |
| InChIKey | MIZKMPAHBUFFCZ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|