C18H18N4OS — CID 113046581
N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 113046581) has the molecular formula C18H18N4OS and a molecular weight of 338.44 g/mol. Its IUPAC name is N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113046581 |
| Molecular Formula | C18H18N4OS |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-[6-(2,3-dimethylanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1cccc(Nc2ccc(NC(=O)Cc3cccs3)nn2)c1C |
| InChI | InChI=1S/C18H18N4OS/c1-12-5-3-7-15(13(12)2)19-16-8-9-17(22-21-16)20-18(23)11-14-6-4-10-24-14/h3-10H,11H2,1-2H3,(H,19,21)(H,20,22,23) |
| InChIKey | PVPPNICQLIHQEK-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |