C16H12Cl2N4OS — CID 113050922
N-[6-(2,3-dichloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide (PubChem CID 113050922) has the molecular formula C16H12Cl2N4OS and a molecular weight of 379.27 g/mol. Its IUPAC name is N-[6-(2,3-dichloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(2,3-dichloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113050922 |
| Molecular Formula | C16H12Cl2N4OS |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 378.01 |
| IUPAC Name | N-[6-(2,3-dichloroanilino)pyridazin-3-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2cccc(Cl)c2Cl)nn1 |
| InChI | InChI=1S/C16H12Cl2N4OS/c17-11-4-1-5-12(16(11)18)19-13-6-7-14(22-21-13)20-15(23)9-10-3-2-8-24-10/h1-8H,9H2,(H,19,21)(H,20,22,23) |
| InChIKey | YTQKSDUKJJAQRE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |