C17H14ClN3OS — CID 113018428
N-[6-(2-chloroanilino)-3-pyridinyl]-2-thiophen-2-ylacetamide (PubChem CID 113018428) has the molecular formula C17H14ClN3OS and a molecular weight of 343.84 g/mol. Its IUPAC name is N-[6-(2-chloroanilino)-3-pyridinyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[6-(2-chloroanilino)-3-pyridinyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113018428 |
| Molecular Formula | C17H14ClN3OS |
| Molecular Weight | 343.84 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | N-[6-(2-chloroanilino)-3-pyridinyl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2ccccc2Cl)nc1 |
| InChI | InChI=1S/C17H14ClN3OS/c18-14-5-1-2-6-15(14)21-16-8-7-12(11-19-16)20-17(22)10-13-4-3-9-23-13/h1-9,11H,10H2,(H,19,21)(H,20,22) |
| InChIKey | CQCQEKBQQXBOAQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.84 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |