C17H13F3N4OS — CID 113048973
2-thiophen-2-yl-N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide (PubChem CID 113048973) has the molecular formula C17H13F3N4OS and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-thiophen-2-yl-N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide.
| Compound Name | 2-thiophen-2-yl-N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 113048973 |
| Molecular Formula | C17H13F3N4OS |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 2-thiophen-2-yl-N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]acetamide |
| SMILES | O=C(Cc1cccs1)Nc1ccc(Nc2cccc(C(F)(F)F)c2)nn1 |
| InChI | InChI=1S/C17H13F3N4OS/c18-17(19,20)11-3-1-4-12(9-11)21-14-6-7-15(24-23-14)22-16(25)10-13-5-2-8-26-13/h1-9H,10H2,(H,21,23)(H,22,24,25) |
| InChIKey | OUZFCXFDDSZIJO-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |