C17H12F3N5O — CID 113048977
N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]pyridine-3-carboxamide (PubChem CID 113048977) has the molecular formula C17H12F3N5O and a molecular weight of 359.31 g/mol. Its IUPAC name is N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]pyridine-3-carboxamide.
| Compound Name | N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 113048977 |
| Molecular Formula | C17H12F3N5O |
| Molecular Weight | 359.31 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[6-[3-(trifluoromethyl)anilino]pyridazin-3-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Nc2cccc(C(F)(F)F)c2)nn1)c1cccnc1 |
| InChI | InChI=1S/C17H12F3N5O/c18-17(19,20)12-4-1-5-13(9-12)22-14-6-7-15(25-24-14)23-16(26)11-3-2-8-21-10-11/h1-10H,(H,22,24)(H,23,25,26) |
| InChIKey | BDBVEMJRKUKBGY-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |