C14H10F3N3O2 — CID 90303181
3-N-[4-(trifluoromethyl)-2-pyridinyl]benzene-1,3-dicarboxamide (PubChem CID 90303181) has the molecular formula C14H10F3N3O2 and a molecular weight of 309.25 g/mol. Its IUPAC name is 3-N-[4-(trifluoromethyl)-2-pyridinyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N-[4-(trifluoromethyl)-2-pyridinyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 90303181 |
| Molecular Formula | C14H10F3N3O2 |
| Molecular Weight | 309.25 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 3-N-[4-(trifluoromethyl)-2-pyridinyl]benzene-1,3-dicarboxamide |
| SMILES | NC(=O)c1cccc(C(=O)Nc2cc(C(F)(F)F)ccn2)c1 |
| InChI | InChI=1S/C14H10F3N3O2/c15-14(16,17)10-4-5-19-11(7-10)20-13(22)9-3-1-2-8(6-9)12(18)21/h1-7H,(H2,18,21)(H,19,20,22) |
| InChIKey | UXCSDKWTUMLUQT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.25 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |