C18H14F3N5O — CID 68969983
3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzamide (PubChem CID 68969983) has the molecular formula C18H14F3N5O and a molecular weight of 373.34 g/mol. Its IUPAC name is 3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzamide.
| Compound Name | 3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 68969983 |
| Molecular Formula | C18H14F3N5O |
| Molecular Weight | 373.34 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 3-[[6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzamide |
| SMILES | NC(=O)c1cccc(Nc2cc(Nc3cccc(C(F)(F)F)c3)ncn2)c1 |
| InChI | InChI=1S/C18H14F3N5O/c19-18(20,21)12-4-2-6-14(8-12)26-16-9-15(23-10-24-16)25-13-5-1-3-11(7-13)17(22)27/h1-10H,(H2,22,27)(H2,23,24,25,26) |
| InChIKey | MXDZFZYFYMWXNB-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.34 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |