C19H13F6N3 — CID 11696916
2-N,4-N-bis[3-(trifluoromethyl)phenyl]pyridine-2,4-diamine (PubChem CID 11696916) has the molecular formula C19H13F6N3 and a molecular weight of 397.32 g/mol. Its IUPAC name is 2-N,4-N-bis[3-(trifluoromethyl)phenyl]pyridine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[3-(trifluoromethyl)phenyl]pyridine-2,4-diamine |
|---|---|
| PubChem CID | 11696916 |
| Molecular Formula | C19H13F6N3 |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.10 |
| IUPAC Name | 2-N,4-N-bis[3-(trifluoromethyl)phenyl]pyridine-2,4-diamine |
| SMILES | FC(F)(F)c1cccc(Nc2ccnc(Nc3cccc(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C19H13F6N3/c20-18(21,22)12-3-1-5-14(9-12)27-16-7-8-26-17(11-16)28-15-6-2-4-13(10-15)19(23,24)25/h1-11H,(H2,26,27,28) |
| InChIKey | OMJPKBHPEZBRLI-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |