C18H13F3N4O — CID 59982989
3-[6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]benzamide (PubChem CID 59982989) has the molecular formula C18H13F3N4O and a molecular weight of 358.32 g/mol. Its IUPAC name is 3-[6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | 3-[6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 59982989 |
| Molecular Formula | C18H13F3N4O |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 3-[6-[4-(trifluoromethyl)anilino]pyrimidin-4-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2cc(Nc3ccc(C(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C18H13F3N4O/c19-18(20,21)13-4-6-14(7-5-13)25-16-9-15(23-10-24-16)11-2-1-3-12(8-11)17(22)26/h1-10H,(H2,22,26)(H,23,24,25) |
| InChIKey | WNAXWPUIQCYLSO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |