C22H23FN4O3 — CID 144886669
3-[6-[4-(2-fluoropropan-2-yloxy)anilino]pyrimidin-4-yl]-N-(2-hydroxyethyl)benzamide (PubChem CID 144886669) has the molecular formula C22H23FN4O3 and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-[6-[4-(2-fluoropropan-2-yloxy)anilino]pyrimidin-4-yl]-N-(2-hydroxyethyl)benzamide.
| Compound Name | 3-[6-[4-(2-fluoropropan-2-yloxy)anilino]pyrimidin-4-yl]-N-(2-hydroxyethyl)benzamide |
|---|---|
| PubChem CID | 144886669 |
| Molecular Formula | C22H23FN4O3 |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 3-[6-[4-(2-fluoropropan-2-yloxy)anilino]pyrimidin-4-yl]-N-(2-hydroxyethyl)benzamide |
| SMILES | CC(C)(F)Oc1ccc(Nc2cc(-c3cccc(C(=O)NCCO)c3)ncn2)cc1 |
| InChI | InChI=1S/C22H23FN4O3/c1-22(2,23)30-18-8-6-17(7-9-18)27-20-13-19(25-14-26-20)15-4-3-5-16(12-15)21(29)24-10-11-28/h3-9,12-14,28H,10-11H2,1-2H3,(H,24,29)(H,25,26,27) |
| InChIKey | ZPQFBYVBDYKGDU-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 96.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |