C31H33F3N4O5 — CID 144886651
N-[2-[2-[2-[[(4S)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl]-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide (PubChem CID 144886651) has the molecular formula C31H33F3N4O5 and a molecular weight of 598.62 g/mol. Its IUPAC name is N-[2-[2-[2-[[(4S)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl]-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | N-[2-[2-[2-[[(4S)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl]-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 144886651 |
| Molecular Formula | C31H33F3N4O5 |
| Molecular Weight | 598.62 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | N-[2-[2-[2-[[(4S)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl]-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| SMILES | O=C(NCCOCCOCCOCC1C[C@H]2C=CC12)c1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C31H33F3N4O5/c32-31(33,34)43-26-7-5-25(6-8-26)38-29-18-28(36-20-37-29)22-2-1-3-23(17-22)30(39)35-10-11-40-12-13-41-14-15-42-19-24-16-21-4-9-27(21)24/h1-9,17-18,20-21,24,27H,10-16,19H2,(H,35,39)(H,36,37,38)/t21-,24?,27?/m1/s1 |
| InChIKey | YDRNXCAEQCLYDD-SKAWFLRFSA-N |
| XLogP | 5.39 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|