C30H30BF3N4O7 — CID 123871838
[4-[2-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]phenyl]boronic acid (PubChem CID 123871838) has the molecular formula C30H30BF3N4O7 and a molecular weight of 626.40 g/mol. Its IUPAC name is [4-[2-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]phenyl]boronic acid.
| Compound Name | [4-[2-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]phenyl]boronic acid |
|---|---|
| PubChem CID | 123871838 |
| Molecular Formula | C30H30BF3N4O7 |
| Molecular Weight | 626.40 g/mol |
| Exact Mass | 626.22 |
| IUPAC Name | [4-[2-[2-[2-[[3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzoyl]amino]ethoxy]ethoxy]ethoxy]phenyl]boronic acid |
| SMILES | O=C(NCCOCCOCCOc1ccc(B(O)O)cc1)c1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C30H30BF3N4O7/c32-30(33,34)45-26-10-6-24(7-11-26)38-28-19-27(36-20-37-28)21-2-1-3-22(18-21)29(39)35-12-13-42-14-15-43-16-17-44-25-8-4-23(5-9-25)31(40)41/h1-11,18-20,40-41H,12-17H2,(H,35,39)(H,36,37,38) |
| InChIKey | ZNJUIBSGHDZFCZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 144.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|