C24H18F3N5O2 — CID 59982983
N-(pyridin-4-ylmethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide (PubChem CID 59982983) has the molecular formula C24H18F3N5O2 and a molecular weight of 465.44 g/mol. Its IUPAC name is N-(pyridin-4-ylmethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | N-(pyridin-4-ylmethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 59982983 |
| Molecular Formula | C24H18F3N5O2 |
| Molecular Weight | 465.44 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-(pyridin-4-ylmethyl)-3-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| SMILES | O=C(NCc1ccncc1)c1cccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1 |
| InChI | InChI=1S/C24H18F3N5O2/c25-24(26,27)34-20-6-4-19(5-7-20)32-22-13-21(30-15-31-22)17-2-1-3-18(12-17)23(33)29-14-16-8-10-28-11-9-16/h1-13,15H,14H2,(H,29,33)(H,30,31,32) |
| InChIKey | CRJLYECSSQEYLO-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.44 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |