C22H21F3N4O2 — CID 143814531
3-methyl-N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]butanamide (PubChem CID 143814531) has the molecular formula C22H21F3N4O2 and a molecular weight of 430.43 g/mol. Its IUPAC name is 3-methyl-N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]butanamide.
| Compound Name | 3-methyl-N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]butanamide |
|---|---|
| PubChem CID | 143814531 |
| Molecular Formula | C22H21F3N4O2 |
| Molecular Weight | 430.43 g/mol |
| Exact Mass | 430.16 |
| IUPAC Name | 3-methyl-N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]butanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C22H21F3N4O2/c1-14(2)11-21(30)29-17-5-3-15(4-6-17)19-12-20(27-13-26-19)28-16-7-9-18(10-8-16)31-22(23,24)25/h3-10,12-14H,11H2,1-2H3,(H,29,30)(H,26,27,28) |
| InChIKey | OLGWEJAFWJJGMG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.43 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |