C21H21F3N4O3S — CID 58560869
N,N-diethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide (PubChem CID 58560869) has the molecular formula C21H21F3N4O3S and a molecular weight of 466.49 g/mol. Its IUPAC name is N,N-diethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 58560869 |
| Molecular Formula | C21H21F3N4O3S |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N,N-diethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C21H21F3N4O3S/c1-3-28(4-2)32(29,30)18-11-5-15(6-12-18)19-13-20(26-14-25-19)27-16-7-9-17(10-8-16)31-21(22,23)24/h5-14H,3-4H2,1-2H3,(H,25,26,27) |
| InChIKey | LXWAWZXJJMIHBW-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |