C22H23ClN4O4S — CID 166327245
2-chloro-5-(diethylsulfamoyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]benzamide (PubChem CID 166327245) has the molecular formula C22H23ClN4O4S and a molecular weight of 474.97 g/mol. Its IUPAC name is 2-chloro-5-(diethylsulfamoyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]benzamide.
| Compound Name | 2-chloro-5-(diethylsulfamoyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 166327245 |
| Molecular Formula | C22H23ClN4O4S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | 2-chloro-5-(diethylsulfamoyl)-N-[6-(4-methoxyphenyl)pyrimidin-4-yl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(C(=O)Nc2cc(-c3ccc(OC)cc3)ncn2)c1 |
| InChI | InChI=1S/C22H23ClN4O4S/c1-4-27(5-2)32(29,30)17-10-11-19(23)18(12-17)22(28)26-21-13-20(24-14-25-21)15-6-8-16(31-3)9-7-15/h6-14H,4-5H2,1-3H3,(H,24,25,26,28) |
| InChIKey | SPYLVZRHHDXLLU-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |