C22H21F3N4O3S — CID 42635096
6-(4-piperidin-1-ylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine (PubChem CID 42635096) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is 6-(4-piperidin-1-ylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine.
| Compound Name | 6-(4-piperidin-1-ylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 42635096 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 6-(4-piperidin-1-ylsulfonylphenyl)-N-[4-(trifluoromethoxy)phenyl]pyrimidin-4-amine |
| SMILES | O=S(=O)(c1ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C22H21F3N4O3S/c23-22(24,25)32-18-8-6-17(7-9-18)28-21-14-20(26-15-27-21)16-4-10-19(11-5-16)33(30,31)29-12-2-1-3-13-29/h4-11,14-15H,1-3,12-13H2,(H,26,27,28) |
| InChIKey | MBJMKJJABLGJAJ-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |