C22H23F3N4O3S — CID 58560806
N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]pentane-2-sulfonamide (PubChem CID 58560806) has the molecular formula C22H23F3N4O3S and a molecular weight of 480.51 g/mol. Its IUPAC name is N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]pentane-2-sulfonamide.
| Compound Name | N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]pentane-2-sulfonamide |
|---|---|
| PubChem CID | 58560806 |
| Molecular Formula | C22H23F3N4O3S |
| Molecular Weight | 480.51 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | N-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]phenyl]pentane-2-sulfonamide |
| SMILES | CCCC(C)S(=O)(=O)Nc1ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cc1 |
| InChI | InChI=1S/C22H23F3N4O3S/c1-3-4-15(2)33(30,31)29-18-7-5-16(6-8-18)20-13-21(27-14-26-20)28-17-9-11-19(12-10-17)32-22(23,24)25/h5-15,29H,3-4H2,1-2H3,(H,26,27,28) |
| InChIKey | WZGIJSGOZRKXTA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |