C20H17F3N4O2 — CID 174488015
2,3-dimethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide (PubChem CID 174488015) has the molecular formula C20H17F3N4O2 and a molecular weight of 402.38 g/mol. Its IUPAC name is 2,3-dimethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide.
| Compound Name | 2,3-dimethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
|---|---|
| PubChem CID | 174488015 |
| Molecular Formula | C20H17F3N4O2 |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.13 |
| IUPAC Name | 2,3-dimethyl-4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]benzamide |
| SMILES | Cc1c(C(N)=O)ccc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)c1C |
| InChI | InChI=1S/C20H17F3N4O2/c1-11-12(2)16(19(24)28)8-7-15(11)17-9-18(26-10-25-17)27-13-3-5-14(6-4-13)29-20(21,22)23/h3-10H,1-2H3,(H2,24,28)(H,25,26,27) |
| InChIKey | NLOLDKJDORDDFS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |