C22H26F3N5O5 — CID 118226334
2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethanol (PubChem CID 118226334) has the molecular formula C22H26F3N5O5 and a molecular weight of 497.47 g/mol. Its IUPAC name is 2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethanol.
| Compound Name | 2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 118226334 |
| Molecular Formula | C22H26F3N5O5 |
| Molecular Weight | 497.47 g/mol |
| Exact Mass | 497.19 |
| IUPAC Name | 2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethanol |
| SMILES | OCCOCCOCCOCCn1cc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cn1 |
| InChI | InChI=1S/C22H26F3N5O5/c23-22(24,25)35-19-3-1-18(2-4-19)29-21-13-20(26-16-27-21)17-14-28-30(15-17)5-7-32-9-11-34-12-10-33-8-6-31/h1-4,13-16,31H,5-12H2,(H,26,27,29) |
| InChIKey | CRAMHQZUBQJFGE-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|