C23H27F3N6O5 — CID 144886710
N-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]formamide (PubChem CID 144886710) has the molecular formula C23H27F3N6O5 and a molecular weight of 524.50 g/mol. Its IUPAC name is N-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]formamide.
| Compound Name | N-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]formamide |
|---|---|
| PubChem CID | 144886710 |
| Molecular Formula | C23H27F3N6O5 |
| Molecular Weight | 524.50 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | N-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]formamide |
| SMILES | O=CNCCOCCOCCOCCn1cc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cn1 |
| InChI | InChI=1S/C23H27F3N6O5/c24-23(25,26)37-20-3-1-19(2-4-20)31-22-13-21(28-16-29-22)18-14-30-32(15-18)6-8-35-10-12-36-11-9-34-7-5-27-17-33/h1-4,13-17H,5-12H2,(H,27,33)(H,28,29,31) |
| InChIKey | XZBSIQALHSMONI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|