C31H36F3N6O5+ — CID 123944518
2-bicyclo[2.2.1]hept-5-enylmethylidene-formyl-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]azanium (PubChem CID 123944518) has the molecular formula C31H36F3N6O5+ and a molecular weight of 629.66 g/mol. Its IUPAC name is 2-bicyclo[2.2.1]hept-5-enylmethylidene-formyl-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]azanium.
| Compound Name | 2-bicyclo[2.2.1]hept-5-enylmethylidene-formyl-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 123944518 |
| Molecular Formula | C31H36F3N6O5+ |
| Molecular Weight | 629.66 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | 2-bicyclo[2.2.1]hept-5-enylmethylidene-formyl-[2-[2-[2-[2-[4-[6-[4-(trifluoromethoxy)anilino]pyrimidin-4-yl]pyrazol-1-yl]ethoxy]ethoxy]ethoxy]ethyl]azanium |
| SMILES | O=C/[N+](=C/C1CC2C=CC1C2)CCOCCOCCOCCn1cc(-c2cc(Nc3ccc(OC(F)(F)F)cc3)ncn2)cn1 |
| InChI | InChI=1S/C31H36F3N6O5/c32-31(33,34)45-28-5-3-27(4-6-28)38-30-17-29(35-21-36-30)26-18-37-40(20-26)8-10-43-12-14-44-13-11-42-9-7-39(22-41)19-25-16-23-1-2-24(25)15-23/h1-6,17-25H,7-16H2,(H,35,36,38)/q+1/b39-19+ |
| InChIKey | HCBPTUQQJRLSNC-NNRJCLOKSA-N |
| XLogP | 4.48 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.66 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|