C19H13F3N2O2 — CID 68648982
2-N-[3-(trifluoromethyl)phenyl]naphthalene-2,7-dicarboxamide (PubChem CID 68648982) has the molecular formula C19H13F3N2O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 2-N-[3-(trifluoromethyl)phenyl]naphthalene-2,7-dicarboxamide.
| Compound Name | 2-N-[3-(trifluoromethyl)phenyl]naphthalene-2,7-dicarboxamide |
|---|---|
| PubChem CID | 68648982 |
| Molecular Formula | C19H13F3N2O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 2-N-[3-(trifluoromethyl)phenyl]naphthalene-2,7-dicarboxamide |
| SMILES | NC(=O)c1ccc2ccc(C(=O)Nc3cccc(C(F)(F)F)c3)cc2c1 |
| InChI | InChI=1S/C19H13F3N2O2/c20-19(21,22)15-2-1-3-16(10-15)24-18(26)13-7-5-11-4-6-12(17(23)25)8-14(11)9-13/h1-10H,(H2,23,25)(H,24,26) |
| InChIKey | CJGOASPZYKEFQJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |