C16H13F3N2O2 — CID 68505609
4-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide (PubChem CID 68505609) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide.
| Compound Name | 4-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68505609 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 4-methyl-1-N-[3-(trifluoromethyl)phenyl]benzene-1,3-dicarboxamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1C(N)=O |
| InChI | InChI=1S/C16H13F3N2O2/c1-9-5-6-10(7-13(9)14(20)22)15(23)21-12-4-2-3-11(8-12)16(17,18)19/h2-8H,1H3,(H2,20,22)(H,21,23) |
| InChIKey | SDWCRJCPJXUZOZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |