C21H17F3N2O — CID 69043668
3-(3-aminophenyl)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 69043668) has the molecular formula C21H17F3N2O and a molecular weight of 370.37 g/mol. Its IUPAC name is 3-(3-aminophenyl)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(3-aminophenyl)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 69043668 |
| Molecular Formula | C21H17F3N2O |
| Molecular Weight | 370.37 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-(3-aminophenyl)-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)cc1-c1cccc(N)c1 |
| InChI | InChI=1S/C21H17F3N2O/c1-13-8-9-15(11-19(13)14-4-2-6-17(25)10-14)20(27)26-18-7-3-5-16(12-18)21(22,23)24/h2-12H,25H2,1H3,(H,26,27) |
| InChIKey | XNKDHTWOOCLROJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.37 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|