C17H13F3N4O2S3 — CID 40833739
N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide (PubChem CID 40833739) has the molecular formula C17H13F3N4O2S3 and a molecular weight of 458.51 g/mol. Its IUPAC name is N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 40833739 |
| Molecular Formula | C17H13F3N4O2S3 |
| Molecular Weight | 458.51 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | N-[5-[2-oxo-2-[3-(trifluoromethyl)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-thiophen-2-ylacetamide |
| SMILES | O=C(CSc1nnc(NC(=O)Cc2cccs2)s1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3N4O2S3/c18-17(19,20)10-3-1-4-11(7-10)21-14(26)9-28-16-24-23-15(29-16)22-13(25)8-12-5-2-6-27-12/h1-7H,8-9H2,(H,21,26)(H,22,23,25) |
| InChIKey | PAILJRVVQJXOEH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|