C16H13F3N4OS3 — CID 56545352
N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56545352) has the molecular formula C16H13F3N4OS3 and a molecular weight of 430.50 g/mol. Its IUPAC name is N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56545352 |
| Molecular Formula | C16H13F3N4OS3 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.02 |
| IUPAC Name | N-[5-(thiophen-2-ylmethylsulfanyl)-1,3,4-thiadiazol-2-yl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)Nc1nnc(SCc2cccs2)s1 |
| InChI | InChI=1S/C16H13F3N4OS3/c17-16(18,19)10-3-1-4-11(7-10)20-8-13(24)21-14-22-23-15(27-14)26-9-12-5-2-6-25-12/h1-7,20H,8-9H2,(H,21,22,24) |
| InChIKey | IXRHVDWONFGOHV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|