C20H16F3N3O2S — CID 56538607
N-[3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 56538607) has the molecular formula C20H16F3N3O2S and a molecular weight of 419.43 g/mol. Its IUPAC name is N-[3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 56538607 |
| Molecular Formula | C20H16F3N3O2S |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | N-[3-[[2-[3-(trifluoromethyl)anilino]acetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)Nc1cccc(NC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C20H16F3N3O2S/c21-20(22,23)13-4-1-5-14(10-13)24-12-18(27)25-15-6-2-7-16(11-15)26-19(28)17-8-3-9-29-17/h1-11,24H,12H2,(H,25,27)(H,26,28) |
| InChIKey | XPWGRMHWVZRGLA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |