C19H13F3N2O2S — CID 24671974
N-[2-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide (PubChem CID 24671974) has the molecular formula C19H13F3N2O2S and a molecular weight of 390.39 g/mol. Its IUPAC name is N-[2-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 24671974 |
| Molecular Formula | C19H13F3N2O2S |
| Molecular Weight | 390.39 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | N-[2-[[3-(trifluoromethyl)phenyl]carbamoyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)Nc1cccc(C(F)(F)F)c1)c1cccs1 |
| InChI | InChI=1S/C19H13F3N2O2S/c20-19(21,22)12-5-3-6-13(11-12)23-17(25)14-7-1-2-8-15(14)24-18(26)16-9-4-10-27-16/h1-11H,(H,23,25)(H,24,26) |
| InChIKey | MNZDBXKQLWJPSS-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.39 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |