C20H14F4N2O — CID 10547402
2-fluoro-N-phenyl-3-[3-(trifluoromethyl)anilino]benzamide (PubChem CID 10547402) has the molecular formula C20H14F4N2O and a molecular weight of 374.34 g/mol. Its IUPAC name is 2-fluoro-N-phenyl-3-[3-(trifluoromethyl)anilino]benzamide.
| Compound Name | 2-fluoro-N-phenyl-3-[3-(trifluoromethyl)anilino]benzamide |
|---|---|
| PubChem CID | 10547402 |
| Molecular Formula | C20H14F4N2O |
| Molecular Weight | 374.34 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-fluoro-N-phenyl-3-[3-(trifluoromethyl)anilino]benzamide |
| SMILES | O=C(Nc1ccccc1)c1cccc(Nc2cccc(C(F)(F)F)c2)c1F |
| InChI | InChI=1S/C20H14F4N2O/c21-18-16(19(27)26-14-7-2-1-3-8-14)10-5-11-17(18)25-15-9-4-6-13(12-15)20(22,23)24/h1-12,25H,(H,26,27) |
| InChIKey | MBWNWSIMBIWRCY-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |