C21H15F5N2OS — CID 2321982
2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 2321982) has the molecular formula C21H15F5N2OS and a molecular weight of 438.42 g/mol. Its IUPAC name is 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2321982 |
| Molecular Formula | C21H15F5N2OS |
| Molecular Weight | 438.42 g/mol |
| Exact Mass | 438.08 |
| IUPAC Name | 2-[4-(difluoromethylsulfanyl)anilino]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccccc1Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C21H15F5N2OS/c22-20(23)30-16-10-8-14(9-11-16)27-18-7-2-1-6-17(18)19(29)28-15-5-3-4-13(12-15)21(24,25)26/h1-12,20,27H,(H,28,29) |
| InChIKey | BHJHPBVDGIXULH-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.42 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |