C15H10F5NOS — CID 2567810
N-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)benzamide (PubChem CID 2567810) has the molecular formula C15H10F5NOS and a molecular weight of 347.31 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 2567810 |
| Molecular Formula | C15H10F5NOS |
| Molecular Weight | 347.31 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F5NOS/c16-14(17)23-12-7-5-11(6-8-12)21-13(22)9-1-3-10(4-2-9)15(18,19)20/h1-8,14H,(H,21,22) |
| InChIKey | TUJPYYKRXQMZQG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.31 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |