C16H12F5NO2S — CID 7467585
N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-(trifluoromethyl)phenoxy]acetamide (PubChem CID 7467585) has the molecular formula C16H12F5NO2S and a molecular weight of 377.33 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 7467585 |
| Molecular Formula | C16H12F5NO2S |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-2-[4-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)Nc1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C16H12F5NO2S/c17-15(18)25-13-7-3-11(4-8-13)22-14(23)9-24-12-5-1-10(2-6-12)16(19,20)21/h1-8,15H,9H2,(H,22,23) |
| InChIKey | NWNUGELOEULROT-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |