C18H18F2N2O3S — CID 32940874
4-(difluoromethylsulfanyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]benzamide (PubChem CID 32940874) has the molecular formula C18H18F2N2O3S and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 32940874 |
| Molecular Formula | C18H18F2N2O3S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-[4-[2-(ethylamino)-2-oxoethoxy]phenyl]benzamide |
| SMILES | CCNC(=O)COc1ccc(NC(=O)c2ccc(SC(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H18F2N2O3S/c1-2-21-16(23)11-25-14-7-5-13(6-8-14)22-17(24)12-3-9-15(10-4-12)26-18(19)20/h3-10,18H,2,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | GMUDIAVZCUFUMC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |