C19H19F2NO3S — CID 43011380
N-[4-(difluoromethylsulfanyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 43011380) has the molecular formula C19H19F2NO3S and a molecular weight of 379.43 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfanyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 43011380 |
| Molecular Formula | C19H19F2NO3S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | N-[4-(difluoromethylsulfanyl)phenyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(Nc1ccc(SC(F)F)cc1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H19F2NO3S/c20-19(21)26-17-9-5-14(6-10-17)22-18(23)13-3-7-15(8-4-13)25-12-16-2-1-11-24-16/h3-10,16,19H,1-2,11-12H2,(H,22,23) |
| InChIKey | INMRVWWHJZQEJF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |