C19H18F3NO4 — CID 7987635
4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 7987635) has the molecular formula C19H18F3NO4 and a molecular weight of 381.35 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 7987635 |
| Molecular Formula | C19H18F3NO4 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C19H18F3NO4/c20-19(21,22)27-16-9-5-14(6-10-16)23-18(24)13-3-7-15(8-4-13)26-12-17-2-1-11-25-17/h3-10,17H,1-2,11-12H2,(H,23,24)/t17-/m0/s1 |
| InChIKey | OXEVTCGUFJXDCH-KRWDZBQOSA-N |
| XLogP | 4.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |