C24H23NO3 — CID 9294955
N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-phenylbenzamide (PubChem CID 9294955) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-phenylbenzamide.
| Compound Name | N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 9294955 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | N-[4-[[(2S)-oxolan-2-yl]methoxy]phenyl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccc(OC[C@@H]2CCCO2)cc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO3/c26-24(20-10-8-19(9-11-20)18-5-2-1-3-6-18)25-21-12-14-22(15-13-21)28-17-23-7-4-16-27-23/h1-3,5-6,8-15,23H,4,7,16-17H2,(H,25,26)/t23-/m0/s1 |
| InChIKey | ACKFIGPEJXNEGT-QHCPKHFHSA-N |
| XLogP | 5.16 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |