C26H27NO4 — CID 4957999
N-[4-(oxolan-2-ylmethoxy)phenyl]-4-(2-phenylethoxy)benzamide (PubChem CID 4957999) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is N-[4-(oxolan-2-ylmethoxy)phenyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 4957999 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[4-(oxolan-2-ylmethoxy)phenyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(Nc1ccc(OCC2CCCO2)cc1)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H27NO4/c28-26(27-22-10-14-24(15-11-22)31-19-25-7-4-17-29-25)21-8-12-23(13-9-21)30-18-16-20-5-2-1-3-6-20/h1-3,5-6,8-15,25H,4,7,16-19H2,(H,27,28) |
| InChIKey | QZVRYFDWSBYALD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |