C26H28N2O5S — CID 17222220
4-(oxolan-2-ylmethoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide (PubChem CID 17222220) has the molecular formula C26H28N2O5S and a molecular weight of 480.59 g/mol. Its IUPAC name is 4-(oxolan-2-ylmethoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(oxolan-2-ylmethoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17222220 |
| Molecular Formula | C26H28N2O5S |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | 4-(oxolan-2-ylmethoxy)-N-[4-(2-phenylethylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C26H28N2O5S/c29-26(21-8-12-23(13-9-21)33-19-24-7-4-18-32-24)28-22-10-14-25(15-11-22)34(30,31)27-17-16-20-5-2-1-3-6-20/h1-3,5-6,8-15,24,27H,4,7,16-19H2,(H,28,29) |
| InChIKey | FSOIJQXNNXAZEH-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |