C21H21N3O5S2 — CID 2161674
4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2161674) has the molecular formula C21H21N3O5S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2161674 |
| Molecular Formula | C21H21N3O5S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 4-[[(2S)-oxolan-2-yl]methoxy]-N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2nccs2)cc1)c1ccc(OC[C@@H]2CCCO2)cc1 |
| InChI | InChI=1S/C21H21N3O5S2/c25-20(15-3-7-17(8-4-15)29-14-18-2-1-12-28-18)23-16-5-9-19(10-6-16)31(26,27)24-21-22-11-13-30-21/h3-11,13,18H,1-2,12,14H2,(H,22,24)(H,23,25)/t18-/m0/s1 |
| InChIKey | RFCJYCSOTDFIKE-SFHVURJKSA-N |
| XLogP | 3.75 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |