C27H28N2O4S — CID 17142027
N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17142027) has the molecular formula C27H28N2O4S and a molecular weight of 476.60 g/mol. Its IUPAC name is N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17142027 |
| Molecular Formula | C27H28N2O4S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | N-[[3-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1cccc(OCC2CCCO2)c1)c1ccc(OCCc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O4S/c30-26(21-11-13-23(14-12-21)32-17-15-20-6-2-1-3-7-20)29-27(34)28-22-8-4-9-24(18-22)33-19-25-10-5-16-31-25/h1-4,6-9,11-14,18,25H,5,10,15-17,19H2,(H2,28,29,30,34) |
| InChIKey | NSOMOLBUUOJMFA-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|