C27H27BrN2O4S — CID 17073119
3-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17073119) has the molecular formula C27H27BrN2O4S and a molecular weight of 555.49 g/mol. Its IUPAC name is 3-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073119 |
| Molecular Formula | C27H27BrN2O4S |
| Molecular Weight | 555.49 g/mol |
| Exact Mass | 554.09 |
| IUPAC Name | 3-bromo-N-[[4-(oxolan-2-ylmethoxy)phenyl]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(OCC2CCCO2)cc1)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C27H27BrN2O4S/c28-24-17-20(8-13-25(24)33-16-14-19-5-2-1-3-6-19)26(31)30-27(35)29-21-9-11-22(12-10-21)34-18-23-7-4-15-32-23/h1-3,5-6,8-13,17,23H,4,7,14-16,18H2,(H2,29,30,31,35) |
| InChIKey | NYWYUJRFLMUWHJ-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.49 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|