C26H25BrN2O4S — CID 17072971
propyl 4-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzoate (PubChem CID 17072971) has the molecular formula C26H25BrN2O4S and a molecular weight of 541.47 g/mol. Its IUPAC name is propyl 4-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzoate.
| Compound Name | propyl 4-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 17072971 |
| Molecular Formula | C26H25BrN2O4S |
| Molecular Weight | 541.47 g/mol |
| Exact Mass | 540.07 |
| IUPAC Name | propyl 4-[[3-bromo-4-(2-phenylethoxy)benzoyl]carbamothioylamino]benzoate |
| SMILES | CCCOC(=O)c1ccc(NC(=S)NC(=O)c2ccc(OCCc3ccccc3)c(Br)c2)cc1 |
| InChI | InChI=1S/C26H25BrN2O4S/c1-2-15-33-25(31)19-8-11-21(12-9-19)28-26(34)29-24(30)20-10-13-23(22(27)17-20)32-16-14-18-6-4-3-5-7-18/h3-13,17H,2,14-16H2,1H3,(H2,28,29,30,34) |
| InChIKey | BIGPYFVFUXUSAE-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|