C23H29BrN2O2S — CID 17073002
3-bromo-N-(heptylcarbamothioyl)-4-(2-phenylethoxy)benzamide (PubChem CID 17073002) has the molecular formula C23H29BrN2O2S and a molecular weight of 477.47 g/mol. Its IUPAC name is 3-bromo-N-(heptylcarbamothioyl)-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-(heptylcarbamothioyl)-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17073002 |
| Molecular Formula | C23H29BrN2O2S |
| Molecular Weight | 477.47 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 3-bromo-N-(heptylcarbamothioyl)-4-(2-phenylethoxy)benzamide |
| SMILES | CCCCCCCNC(=S)NC(=O)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C23H29BrN2O2S/c1-2-3-4-5-9-15-25-23(29)26-22(27)19-12-13-21(20(24)17-19)28-16-14-18-10-7-6-8-11-18/h6-8,10-13,17H,2-5,9,14-16H2,1H3,(H2,25,26,27,29) |
| InChIKey | CETSUOLZONOSEH-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.47 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|